CymitQuimica logo

CAS 898788-20-0

:

ethyl 5-oxo-5-[3-(thiomorpholinomethyl)phenyl]pentanoate

Description:
Ethyl 5-oxo-5-[3-(thiomorpholinomethyl)phenyl]pentanoate, identified by its CAS number 898788-20-0, is a chemical compound characterized by its complex structure, which includes an ester functional group and a thiomorpholine moiety. This compound typically exhibits properties associated with both esters and heterocyclic compounds. It is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions and purity. The presence of the thiomorpholine ring suggests potential for unique reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Its ester group may also confer solubility in organic solvents, while the phenyl group can influence its electronic properties and interactions with biological targets. Overall, this compound's characteristics, including its molecular weight, solubility, and reactivity, would be essential for applications in pharmaceuticals or as a synthetic intermediate in organic chemistry. Further studies would be necessary to fully elucidate its physical and chemical properties.
Formula:C18H25NO3S
InChI:InChI=1/C18H25NO3S/c1-2-22-18(21)8-4-7-17(20)16-6-3-5-15(13-16)14-19-9-11-23-12-10-19/h3,5-6,13H,2,4,7-12,14H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1cccc(c1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.