CAS 898788-21-1

1-(2-chlorophenyl)-3-(4-chlorophenyl)propan-1-one

Description:

1-(2-Chlorophenyl)-3-(4-chlorophenyl)propan-1-one, also known as a substituted ketone, is characterized by its structural features, which include a propanone backbone with two chlorophenyl groups attached at the 1 and 3 positions. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic nature. The presence of chlorine substituents on the phenyl rings can influence its chemical reactivity, stability, and biological activity, often enhancing lipophilicity and potentially affecting its interaction with biological targets. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₂Cl₂O

InChI: InChI=1/C15H12Cl2O/c16-12-8-5-11(6-9-12)7-10-15(18)13-3-1-2-4-14(13)17/h1-6,8-9H,7,10H2

SMILES: c1ccc(c(c1)C(=O)CCc1ccc(cc1)Cl)Cl