CAS 898788-22-2
:ethyl 6-oxo-6-[3-(thiomorpholinomethyl)phenyl]hexanoate
Description:
Ethyl 6-oxo-6-[3-(thiomorpholinomethyl)phenyl]hexanoate, identified by its CAS number 898788-22-2, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a thiomorpholine moiety. This compound typically exhibits moderate to high lipophilicity due to the presence of the ethyl ester and aromatic phenyl groups, which can influence its solubility in organic solvents. The thiomorpholine ring contributes to its potential biological activity, possibly enhancing interactions with biological targets. The presence of the ketone group may also impart reactivity, making it a candidate for further chemical modifications. In terms of stability, the compound is likely to be stable under standard laboratory conditions, although specific stability data would depend on environmental factors such as temperature and pH. Overall, this compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, although detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C19H27NO3S
InChI:InChI=1/C19H27NO3S/c1-2-23-19(22)9-4-3-8-18(21)17-7-5-6-16(14-17)15-20-10-12-24-13-11-20/h5-7,14H,2-4,8-13,15H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1cccc(c1)CN1CCSCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.