CAS 898788-23-3
:3-(4-chlorophenyl)-1-(2-fluorophenyl)propan-1-one
Description:
3-(4-chlorophenyl)-1-(2-fluorophenyl)propan-1-one, identified by its CAS number 898788-23-3, is an organic compound characterized by its ketone functional group and a propanone backbone. This compound features a propan-1-one structure with two aromatic substituents: a 4-chlorophenyl group and a 2-fluorophenyl group. The presence of chlorine and fluorine atoms in the phenyl rings contributes to its unique chemical properties, including potential variations in reactivity and polarity. The chlorinated and fluorinated aromatic rings can influence the compound's electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in drug development or as an intermediate in organic synthesis. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with halogenated substituents.
Formula:C15H12ClFO
InChI:InChI=1/C15H12ClFO/c16-12-8-5-11(6-9-12)7-10-15(18)13-3-1-2-4-14(13)17/h1-6,8-9H,7,10H2
SMILES:c1ccc(c(c1)C(=O)CCc1ccc(cc1)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.