CAS 898788-25-5

1-Propanone, 3-(4-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(4-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the chlorine atom and the trifluoromethyl group contributes to its unique chemical properties, including potential reactivity and polarity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can influence their solubility in organic solvents. The trifluoromethyl group is known for imparting significant electronic effects, often enhancing the compound's stability and reactivity in various chemical reactions. Additionally, the presence of halogens can affect the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, this compound's structure suggests potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₆H₁₂ClF₃O

InChI: InChI=1S/C16H12ClF3O/c17-12-8-5-11(6-9-12)7-10-15(21)13-3-1-2-4-14(13)16(18,19)20/h1-6,8-9H,7,10H2

InChI key: InChIKey=RTTNJWMKHIWNOY-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 3-(4-Chlorophenyl)-2′-trifluoromethylpropiophenone
• 1-Propanone, 3-(4-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-
• 3-(4-Chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-1-propanone

3-(4-chlorophenyl)-2′-trifluoromethylpropiophenone

CAS: 898788-25-5

Formula: C₁₆H₁₂ClF₃O

Purity: 97.0%

Molecular weight: 312.72

Ref: 10-F206232