CymitQuimica logo

CAS 898788-26-6

:

ethyl 8-oxo-8-[3-(thiomorpholinomethyl)phenyl]octanoate

Description:
Ethyl 8-oxo-8-[3-(thiomorpholinomethyl)phenyl]octanoate, identified by its CAS number 898788-26-6, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester functional group, a ketone, and a thiomorpholine moiety. This compound typically exhibits moderate to high lipophilicity due to its long carbon chain and aromatic ring, which can influence its solubility and permeability in biological systems. The presence of the thiomorpholine group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its structural features may confer specific reactivity patterns, stability under various conditions, and potential applications in drug development or as a chemical intermediate. Additionally, the compound's unique arrangement of functional groups may lead to interesting pharmacological properties, although specific biological activity would require empirical investigation. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with certain functional groups.
Formula:C21H31NO3S
InChI:InChI=1/C21H31NO3S/c1-2-25-21(24)11-6-4-3-5-10-20(23)19-9-7-8-18(16-19)17-22-12-14-26-15-13-22/h7-9,16H,2-6,10-15,17H2,1H3
SMILES:CCOC(=O)CCCCCCC(=O)c1cccc(c1)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.