CAS 898788-30-2

Methanone, (2-methylphenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2-methylphenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a piperazine moiety suggests potential biological activity, as piperazine derivatives are often found in pharmaceuticals. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its polar piperazine group may enhance solubility in polar solvents. The molecular structure indicates potential for hydrogen bonding and π-π interactions, which could influence its reactivity and interactions with biological targets. Additionally, the presence of methyl groups may affect its steric properties and overall stability. As with many organic compounds, safety data should be consulted to understand its toxicity, handling precautions, and environmental impact. Overall, this compound's unique structure may make it of interest in medicinal chemistry and material science.

Formula: C₂₀H₂₄N₂O

InChI: InChI=1S/C20H24N2O/c1-16-6-3-4-9-19(16)20(23)18-8-5-7-17(14-18)15-22-12-10-21(2)11-13-22/h3-9,14H,10-13,15H2,1-2H3

InChI key: InChIKey=XAUJYNRKNCCAII-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=C(C)C=CC=C3

Synonyms:

• 2-Methyl-3′-(4-methylpiperazinomethyl) benzophenone
• (2-Methylphenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2-methylphenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-