CAS 898788-31-3

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-chlorophenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-chlorophenyl)-, also known by its CAS number 898788-31-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-bromo-2-fluorophenyl group and a 4-chlorophenyl group. The presence of halogen atoms (bromine, fluorine, and chlorine) in the aromatic rings contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogens, which can influence its reactivity and interactions with biological targets. Additionally, the compound's physical properties, such as solubility and boiling point, would be influenced by the presence of these substituents, making it a subject of interest for further study in synthetic chemistry and material science.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1S/C15H11BrClFO/c16-11-4-7-13(14(18)9-11)15(19)8-3-10-1-5-12(17)6-2-10/h1-2,4-7,9H,3,8H2

InChI key: InChIKey=AYOVSLWXJBJHEG-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(4-chlorophenyl)-
• 4′-Bromo-3-(4-chlorophenyl)-2′-fluoropropiophenone

4′-bromo-3-(4-chlorophenyl)-2′-fluoropropiophenone

CAS: 898788-31-3

Formula: C₁₅H₁₁BrClFO

Purity: 97.0%

Molecular weight: 341.6

Ref: 10-F206235