CAS 898788-33-5
:1-(2-chloro-4-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one
Description:
1-(2-Chloro-4-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one, with the CAS number 898788-33-5, is a synthetic organic compound characterized by its complex structure, which includes a propanone backbone substituted with two aromatic rings. The presence of chlorine and fluorine substituents on the phenyl groups contributes to its unique chemical properties, including potential reactivity and biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its solubility in organic solvents and its behavior in biological systems. Additionally, the halogen substituents may enhance its pharmacological profile, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in the synthesis of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as halogenated compounds can pose environmental and health risks. As with any chemical, thorough characterization and analysis are essential for understanding its properties and potential applications.
Formula:C15H11Cl2FO
InChI:InChI=1/C15H11Cl2FO/c16-11-4-1-10(2-5-11)3-8-15(19)13-7-6-12(18)9-14(13)17/h1-2,4-7,9H,3,8H2
SMILES:c1cc(ccc1CCC(=O)c1ccc(cc1Cl)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.