CymitQuimica logo

CAS 898788-34-6

:

[3-[(4-methylpiperazin-1-yl)methyl]phenyl]-(p-tolyl)methanone

Description:
The chemical substance known as [3-[(4-methylpiperazin-1-yl)methyl]phenyl]-(p-tolyl)methanone, with the CAS number 898788-34-6, is a synthetic organic compound that belongs to the class of ketones. It features a complex structure characterized by a phenyl ring substituted with a p-tolyl group and a piperazine moiety, which contributes to its potential biological activity. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to the aromatic groups, which can influence its solubility and permeability in biological systems. Additionally, the methyl substituent on the piperazine can affect its pharmacokinetic profile. While specific biological activities and applications may vary, compounds of this nature are often explored for their potential as pharmaceuticals, particularly in the fields of neuropharmacology and drug development. As with any chemical substance, safety and handling precautions should be observed, and further studies are necessary to fully understand its properties and potential uses.
Formula:C20H24N2O
InChI:InChI=1/C20H24N2O/c1-16-6-8-18(9-7-16)20(23)19-5-3-4-17(14-19)15-22-12-10-21(2)11-13-22/h3-9,14H,10-13,15H2,1-2H3
InChI key:InChIKey=YJGYMXRHKHHRLW-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)C(=O)c1cccc(c1)CN1CCN(C)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.