CAS 898788-37-9

1-(4-chloro-2-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one

Description:

1-(4-chloro-2-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one, identified by its CAS number 898788-37-9, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This substance features a propanone backbone with two distinct phenyl rings, one of which is substituted with both chlorine and fluorine atoms, contributing to its unique chemical properties. The presence of halogen substituents typically influences the compound's reactivity, polarity, and potential biological activity. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and reductions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated compounds are often explored for their enhanced efficacy and specificity. Additionally, its physical properties, such as solubility and melting point, would be influenced by the substituents and overall molecular geometry. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1/C15H11Cl2FO/c16-11-4-1-10(2-5-11)3-8-15(19)13-7-6-12(17)9-14(13)18/h1-2,4-7,9H,3,8H2

SMILES: c1cc(ccc1CCC(=O)c1ccc(cc1F)Cl)Cl