CymitQuimica logo

CAS 898788-38-0

:

(3-methoxyphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
The chemical substance known as (3-methoxyphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898788-38-0, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methoxy group can influence its solubility and reactivity, while the piperazine ring may enhance its pharmacological profile, potentially making it a candidate for various therapeutic applications. The compound is likely to be a solid at room temperature and may have moderate to high stability under standard conditions. Its molecular interactions can be influenced by hydrogen bonding and π-π stacking due to the aromatic components. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential biological effects and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in medicinal chemistry.
Formula:C20H24N2O2
InChI:InChI=1/C20H24N2O2/c1-21-9-11-22(12-10-21)15-16-5-3-6-17(13-16)20(23)18-7-4-8-19(14-18)24-2/h3-8,13-14H,9-12,15H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.