CAS 898788-39-1
:1-Propanone, 3-(4-chlorophenyl)-1-(2,3-dichlorophenyl)-
Description:
1-Propanone, 3-(4-chlorophenyl)-1-(2,3-dichlorophenyl)-, also known by its CAS number 898788-39-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 2,3-dichlorophenyl group. The presence of chlorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds with such substituents may exhibit properties such as increased lipophilicity and altered electronic characteristics, which can influence their interactions in biological systems. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and toxicity. As with many chlorinated compounds, it is essential to handle this substance with care due to potential environmental and health implications.
Formula:C15H11Cl3O
InChI:InChI=1S/C15H11Cl3O/c16-11-7-4-10(5-8-11)6-9-14(19)12-2-1-3-13(17)15(12)18/h1-5,7-8H,6,9H2
InChI key:InChIKey=HZYRRJTYQUEAAR-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(Cl)C(Cl)=CC=C2
Synonyms:- 1-Propanone, 3-(4-chlorophenyl)-1-(2,3-dichlorophenyl)-
- 3-(4-Chlorophenyl)-2′,3′-dichloropropiophenone
- 3-(4-Chlorophenyl)-1-(2,3-dichlorophenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.