CAS 898788-41-5
:1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-
Description:
1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-, also known by its CAS number 898788-41-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 2,4-dichlorophenyl group. The presence of chlorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds with such substituents may exhibit properties such as increased lipophilicity and altered electronic characteristics, which can influence their interactions in biological systems. The compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for detailed analysis. Safety and handling precautions should also be considered, as halogenated compounds can pose environmental and health risks.
Formula:C15H11Cl3O
InChI:InChI=1/C15H11Cl3O/c16-11-4-1-10(2-5-11)3-8-15(19)13-7-6-12(17)9-14(13)18/h1-2,4-7,9H,3,8H2
InChI key:InChIKey=JUIDXPVTRRFKLV-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 3-(4-Chlorophenyl)-2′,4′-dichloropropiophenone
- 3-(4-Chlorophenyl)-1-(2,4-dichlorophenyl)-1-propanone
- 1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.