CAS 898788-44-8

Benzonitrile, 3-[3-[(4-methyl-1-piperazinyl)methyl]benzoyl]-

Description:

Benzonitrile, 3-[3-[(4-methyl-1-piperazinyl)methyl]benzoyl]- is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a piperazine group. This compound typically exhibits properties associated with both aromatic compounds and nitriles, such as moderate polarity and potential solubility in organic solvents. The presence of the piperazine ring suggests that it may have biological activity, potentially interacting with various biological targets due to its ability to form hydrogen bonds and engage in electrostatic interactions. The compound's molecular structure may contribute to its stability and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the methyl group on the piperazine can influence its pharmacokinetic properties, such as lipophilicity and permeability. Overall, this compound's unique characteristics make it a subject of interest for further research in various chemical and pharmaceutical applications.

Formula: C₂₀H₂₁N₃O

InChI: InChI=1/C20H21N3O/c1-22-8-10-23(11-9-22)15-17-5-3-7-19(13-17)20(24)18-6-2-4-16(12-18)14-21/h2-7,12-13H,8-11,15H2,1H3

InChI key: InChIKey=MBBDEYSQGHUTQW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(C#N)=CC=C3

Synonyms:

• Benzonitrile, 3-[3-[(4-methyl-1-piperazinyl)methyl]benzoyl]-
• 3-[3-[(4-Methyl-1-piperazinyl)methyl]benzoyl]benzonitrile
• 3-Cyano-3′-(4-methylpiperazinomethyl) benzophenone
• 3-(3-((4-Methylpiperazin-1-yl)methyl)benzoyl)benzonitrile