CAS 898788-45-9
:1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dichlorophenyl)-
Description:
1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dichlorophenyl)-, also known by its CAS number 898788-45-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 3,5-dichlorophenyl group. The presence of chlorine atoms in the aromatic rings contributes to its chemical properties, potentially enhancing its reactivity and influencing its solubility in various solvents. Typically, compounds with such structural characteristics may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests that it may have moderate to high lipophilicity due to the aromatic rings, which can affect its distribution in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the chlorine substituents. Overall, this compound's unique structure positions it as a candidate for further investigation in various chemical and biological applications.
Formula:C15H11Cl3O
InChI:InChI=1S/C15H11Cl3O/c16-12-4-1-10(2-5-12)3-6-15(19)11-7-13(17)9-14(18)8-11/h1-2,4-5,7-9H,3,6H2
InChI key:InChIKey=XXIUWYJSHKEBNS-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC(Cl)=CC(Cl)=C2
Synonyms:- 1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dichlorophenyl)-
- 3-(4-Chlorophenyl)-3′,5′-dichloropropiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.