CAS 898788-47-1

3-(4-chlorophenyl)-1-(3,4-difluorophenyl)propan-1-one

Description:

3-(4-chlorophenyl)-1-(3,4-difluorophenyl)propan-1-one, with the CAS number 898788-47-1, is an organic compound characterized by its ketone functional group and a propanone backbone. This compound features a chlorophenyl group and a difluorophenyl group, which contribute to its unique chemical properties and potential biological activity. The presence of halogen atoms, specifically chlorine and fluorine, can influence the compound's reactivity, stability, and lipophilicity, making it of interest in medicinal chemistry and material science. The molecular structure suggests that it may exhibit interesting interactions with biological targets, potentially leading to applications in pharmaceuticals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the presence of the halogen substituents. Overall, this compound represents a class of substituted ketones that may have significant implications in various fields, including drug development and chemical synthesis.

Formula: C₁₅H₁₁ClF₂O

InChI: InChI=1/C15H11ClF2O/c16-12-5-1-10(2-6-12)3-8-15(19)11-4-7-13(17)14(18)9-11/h1-2,4-7,9H,3,8H2

SMILES: c1cc(ccc1CCC(=O)c1ccc(c(c1)F)F)Cl

3-(4-chlorophenyl)-3′,4′-difluoropropiophenone

CAS: 898788-47-1

Formula: C₁₅H₁₁ClF₂O

Purity: 97.0%

Molecular weight: 280.7

Ref: 10-F206245