CAS 898788-49-3
:1-Propanone, 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)-
Description:
1-Propanone, 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)-, also known by its CAS number 898788-49-3, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-chlorophenyl group and a 3,5-difluorophenyl group. The presence of chlorine and fluorine atoms introduces significant electronegativity, influencing the compound's reactivity and polarity. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The chlorinated and fluorinated substituents may also impart unique biological activities, making this compound of interest in pharmaceutical and agrochemical research. Additionally, the compound's molecular structure suggests potential applications in materials science and organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.
Formula:C15H11ClF2O
InChI:InChI=1S/C15H11ClF2O/c16-12-4-1-10(2-5-12)3-6-15(19)11-7-13(17)9-14(18)8-11/h1-2,4-5,7-9H,3,6H2
InChI key:InChIKey=CDRHLVQNHVSGNI-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:- 3-(4-Chlorophenyl)-1-(3,5-difluorophenyl)-1-propanone
- 1-Propanone, 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.