CAS 898788-51-7

3-(4-chlorophenyl)-1-(3,4,5-trifluorophenyl)propan-1-one

Description:

3-(4-chlorophenyl)-1-(3,4,5-trifluorophenyl)propan-1-one, with the CAS number 898788-51-7, is an organic compound characterized by its ketone functional group and the presence of multiple aromatic rings. This compound features a propanone backbone, where one end is substituted with a 4-chlorophenyl group and the other with a 3,4,5-trifluorophenyl group. The presence of chlorine and trifluoromethyl groups contributes to its unique electronic properties, potentially enhancing its reactivity and influencing its interactions in biological systems. The trifluoromethyl groups are known for their lipophilicity, which can affect the compound's solubility and permeability in various environments. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₅H₁₀ClF₃O

InChI: InChI=1/C15H10ClF3O/c16-11-4-1-9(2-5-11)3-6-14(20)10-7-12(17)15(19)13(18)8-10/h1-2,4-5,7-8H,3,6H2

SMILES: c1cc(ccc1CCC(=O)c1cc(c(c(c1)F)F)F)Cl