CAS 898788-52-8

ethyl 4-[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate

Description:

Ethyl 4-[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate, with the CAS number 898788-52-8, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group, a benzoyl moiety, and a piperazine derivative. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may impart specific pharmacological activities, potentially influencing its efficacy and safety profile in therapeutic applications. Additionally, the compound's stability, reactivity, and interaction with other substances can vary based on environmental conditions such as pH and temperature. Overall, ethyl 4-[3-[(4-methylpiperazin-1-yl)methyl]benzoyl]benzoate represents a class of compounds that may be explored for various applications, particularly in drug development and chemical synthesis.

Formula: C₂₂H₂₆N₂O₃

InChI: InChI=1/C22H26N2O3/c1-3-27-22(26)19-9-7-18(8-10-19)21(25)20-6-4-5-17(15-20)16-24-13-11-23(2)12-14-24/h4-10,15H,3,11-14,16H2,1-2H3

SMILES: CCOC(=O)c1ccc(cc1)C(=O)c1cccc(c1)CN1CCN(C)CC1