CAS 898788-55-1
:3-(4-Chlorophenyl)-1-cyclopropyl-1-propanone
Description:
3-(4-Chlorophenyl)-1-cyclopropyl-1-propanone, also known by its CAS number 898788-55-1, is a synthetic organic compound characterized by its unique molecular structure, which includes a cyclopropyl group and a chlorophenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature. It is primarily studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive compounds. The presence of the chlorophenyl group may influence its biological activity and pharmacokinetic properties, making it a subject of interest in drug design. Additionally, the compound's reactivity can be attributed to the ketone functional group, which may participate in various chemical reactions, including nucleophilic additions. Safety and handling precautions are essential when working with this compound, as with many synthetic chemicals, due to potential toxicity and environmental impact.
Formula:C12H13ClO
InChI:InChI=1S/C12H13ClO/c13-11-6-1-9(2-7-11)3-8-12(14)10-4-5-10/h1-2,6-7,10H,3-5,8H2
InChI key:InChIKey=RPMZWWZAIIBKFH-UHFFFAOYSA-N
SMILES:C(CCC1=CC=C(Cl)C=C1)(=O)C2CC2
Synonyms:- 3-(4-Chlorophenyl)-1-cyclopropyl-1-propanone
- 2-(4-Chlorophenyl)ethyl cyclopropyl ketone
- 1-Propanone, 3-(4-chlorophenyl)-1-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.