CAS 898788-57-3
:3-(4-chlorophenyl)-1-cyclobutyl-propan-1-one
Description:
3-(4-Chlorophenyl)-1-cyclobutyl-propan-1-one, identified by its CAS number 898788-57-3, is an organic compound characterized by its unique molecular structure, which includes a cyclobutyl group and a chlorophenyl moiety. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-chlorophenyl group may influence its electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the cyclobutyl ring introduces strain, which can affect the compound's stability and reactivity. This substance may be of interest in medicinal chemistry and material science due to its structural features, which could lead to the development of novel pharmaceuticals or functional materials. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C13H15ClO
InChI:InChI=1/C13H15ClO/c14-12-7-4-10(5-8-12)6-9-13(15)11-2-1-3-11/h4-5,7-8,11H,1-3,6,9H2
SMILES:C1CC(C1)C(=O)CCc1ccc(cc1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.