CAS 898788-58-4

Methanone, (3-bromophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-bromophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a bromine atom on one of the phenyl rings contributes to its reactivity and potential applications in medicinal chemistry. The compound also features a piperazine moiety, which is known for its biological activity and is often found in pharmaceuticals. This structure suggests potential interactions with biological targets, making it of interest in drug development. The compound's molecular framework indicates it may exhibit properties such as lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the presence of substituents like the methyl group on the piperazine can affect its pharmacokinetic and pharmacodynamic profiles. Overall, this compound exemplifies the intricate relationship between chemical structure and biological activity, highlighting its potential utility in various chemical and pharmaceutical applications.

Formula: C₁₉H₂₁BrN₂O

InChI: InChI=1S/C19H21BrN2O/c1-21-8-10-22(11-9-21)14-15-4-2-5-16(12-15)19(23)17-6-3-7-18(20)13-17/h2-7,12-13H,8-11,14H2,1H3

InChI key: InChIKey=ZYLPOBVUYARNLN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(Br)=CC=C3

Synonyms:

• (3-Bromophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 3-Bromo-3′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-bromophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

3-bromo-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-58-4

Formula: C₁₉H₂₁BrN₂O

Purity: 97.0%

Molecular weight: 373.294

Ref: 10-F205012