CAS 898788-72-2
:(2,4-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (2,4-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898788-72-2, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, indicating potential biological activity, particularly in pharmacological applications. Its molecular structure suggests it may exhibit lipophilicity, which can influence its solubility and permeability in biological systems. The presence of the piperazine ring often correlates with interactions at neurotransmitter receptors, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its synthesis and potential applications. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic research.
Formula:C21H26N2O
InChI:InChI=1/C21H26N2O/c1-16-7-8-20(17(2)13-16)21(24)19-6-4-5-18(14-19)15-23-11-9-22(3)10-12-23/h4-8,13-14H,9-12,15H2,1-3H3
SMILES:Cc1ccc(c(C)c1)C(=O)c1cccc(c1)CN1CCN(C)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.