CAS 898788-73-3
:3-(3-fluorophenyl)-1-(3-methoxyphenyl)propan-1-one
Description:
3-(3-fluorophenyl)-1-(3-methoxyphenyl)propan-1-one, identified by its CAS number 898788-73-3, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a 3-fluorophenyl group and a 3-methoxyphenyl group. The presence of the fluorine atom on one aromatic ring can influence the compound's electronic properties, potentially enhancing its reactivity and affecting its interactions with biological targets. The methoxy group on the other aromatic ring can also contribute to the compound's lipophilicity and solubility in organic solvents. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological activities. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential biological activity associated with its structure.
Formula:C16H15FO2
InChI:InChI=1/C16H15FO2/c1-19-15-7-3-5-13(11-15)16(18)9-8-12-4-2-6-14(17)10-12/h2-7,10-11H,8-9H2,1H3
InChI key:InChIKey=JRHRTKLEEGYFNH-UHFFFAOYSA-N
SMILES:COc1cccc(c1)C(=O)CCc1cccc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.