CymitQuimica logo

CAS 898788-74-4

:

(2,5-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
The chemical substance known as (2,5-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898788-74-4, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, which is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperazine ring suggests potential biological activity, as piperazine derivatives are often explored for their effects on the central nervous system and other therapeutic areas. The compound's molecular structure contributes to its solubility and reactivity, influencing its interactions in biological systems. Additionally, the presence of multiple functional groups may enhance its ability to form hydrogen bonds, impacting its pharmacokinetic properties. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in drug discovery and development.
Formula:C21H26N2O
InChI:InChI=1/C21H26N2O/c1-16-7-8-17(2)20(13-16)21(24)19-6-4-5-18(14-19)15-23-11-9-22(3)10-12-23/h4-8,13-14H,9-12,15H2,1-3H3
SMILES:Cc1ccc(C)c(c1)C(=O)c1cccc(c1)CN1CCN(C)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.