CAS 898788-77-7
:(2,6-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone
Description:
The chemical substance known as (2,6-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898788-77-7, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, which is known for its biological activity and potential pharmacological applications. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic components, influencing its solubility and permeability in biological systems. Additionally, its molecular structure may confer specific reactivity patterns, making it suitable for various chemical reactions. Overall, this compound's unique features position it as a candidate for further research in drug development and related fields.
Formula:C21H26N2O
InChI:InChI=1/C21H26N2O/c1-16-6-4-7-17(2)20(16)21(24)19-9-5-8-18(14-19)15-23-12-10-22(3)11-13-23/h4-9,14H,10-13,15H2,1-3H3
SMILES:Cc1cccc(C)c1C(=O)c1cccc(c1)CN1CCN(C)CC1
Synonyms:- (2,6-Dimethylphenyl)(3-((4-methylpiperazin-1-yl)methyl)phenyl)methanone
- 2,6-DIMETHYL-3'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
- Methanone, (2,6-dimethylphenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.