CAS 898788-80-2

(3,4-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:

The chemical substance known as (3,4-dimethylphenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898788-80-2, is a synthetic organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. This compound features a dimethyl-substituted phenyl group and a piperazine moiety, indicating potential biological activity, particularly in pharmacological contexts. The presence of the piperazine ring suggests that it may interact with various biological targets, potentially influencing neurotransmitter systems. Its molecular structure contributes to its lipophilicity, which can affect its solubility and permeability in biological systems. Additionally, the compound may exhibit specific reactivity patterns typical of ketones and aromatic compounds, making it of interest in medicinal chemistry and drug development. As with many synthetic compounds, safety and handling precautions are essential, and its properties should be evaluated through experimental studies to fully understand its behavior and potential applications.

Formula: C₂₁H₂₆N₂O

InChI: InChI=1/C21H26N2O/c1-16-7-8-20(13-17(16)2)21(24)19-6-4-5-18(14-19)15-23-11-9-22(3)10-12-23/h4-8,13-14H,9-12,15H2,1-3H3

SMILES: Cc1ccc(cc1C)C(=O)c1cccc(c1)CN1CCN(C)CC1