CymitQuimica logo

CAS 898788-84-6

:

1-(3,5-dichlorophenyl)-3-phenyl-propan-1-one

Description:
1-(3,5-Dichlorophenyl)-3-phenyl-propan-1-one, with the CAS number 898788-84-6, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 3,5-dichlorophenyl group and a phenyl group, contributing to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a crystalline structure. The presence of chlorine atoms enhances its lipophilicity and may influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its molecular structure suggests potential for interactions with biological systems, which could be explored for therapeutic uses. Additionally, the compound's stability and solubility characteristics are influenced by the substituents on the aromatic rings, which can affect its behavior in different solvents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12Cl2O
InChI:InChI=1/C15H12Cl2O/c16-13-8-12(9-14(17)10-13)15(18)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2
SMILES:c1ccc(cc1)CCC(=O)c1cc(cc(c1)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.