CAS 898788-86-8

Methanone, (4-bromo-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-bromo-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacology, often enhancing the compound's interaction with biological targets. This substance is likely to exhibit properties such as moderate solubility in organic solvents and potential lipophilicity due to its aromatic and aliphatic components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may act as intermediates or active ingredients. As with many synthetic organic compounds, safety and handling precautions are essential, given the presence of halogenated substituents, which can influence toxicity and environmental impact.

Formula: C₁₉H₂₀BrFN₂O

InChI: InChI=1S/C19H20BrFN2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)16-5-6-17(20)18(21)12-16/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=NOHOKOKTOHBLAQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(F)=C(Br)C=C3

Synonyms:

• 4-Bromo-3-fluoro-3′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (4-bromo-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (4-Bromo-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

4-bromo-3-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-86-8

Formula: C₁₉H₂₀BrFN₂O

Purity: 97.0%

Molecular weight: 391.284

Ref: 10-F205024