CAS 898788-89-1

Methanone, (4-chloro-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-chloro-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its specific functional groups and structural features. It contains a methanone functional group, indicating the presence of a carbonyl (C=O) group bonded to an aromatic system. The compound features a 4-chloro-3-fluorophenyl moiety, which introduces halogen substituents that can influence its reactivity and biological activity. Additionally, the presence of a piperazine ring, specifically substituted with a methyl group, suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The overall structure indicates that it may exhibit properties such as lipophilicity and the ability to engage in hydrogen bonding, which are critical for its pharmacological profile. The compound's CAS number, 898788-89-1, allows for its identification in chemical databases, facilitating research and development in various applications, particularly in drug discovery and development.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)16-5-6-17(20)18(21)12-16/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=DQGRRQOFIRHPJR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(F)=C(Cl)C=C3

Synonyms:

• 4-Chloro-3-fluoro-3′-(4-methylpiperazinomethyl )benzophenone
• (4-Chloro-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (4-chloro-3-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

4-chloro-3-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-89-1

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205025