CAS 898788-92-6

Methanone, (3-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacology, often enhancing the compound's interaction with biological targets. This substance is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may exhibit specific properties such as lipophilicity and the ability to form hydrogen bonds, which are crucial for its interaction with biological systems. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, this compound exemplifies the intricate design often found in drug development, aiming to optimize efficacy and minimize side effects.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)16-5-6-18(21)17(20)12-16/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=PZKXNQFIGIQRBB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• 3-Chloro-4-fluoro-3′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (3-Chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

3-chloro-4-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-92-6

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205026