CAS 898788-93-7

1-Propanone, 1-(3,5-difluorophenyl)-3-phenyl-

Description:

1-Propanone, 1-(3,5-difluorophenyl)-3-phenyl-, also known by its CAS number 898788-93-7, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,5-difluorophenyl group and a phenyl group. The presence of fluorine atoms in the 3 and 5 positions of the phenyl ring can significantly influence the compound's chemical properties, such as its reactivity and polarity. Typically, compounds like this exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in organic solvents. The ketone functional group contributes to the compound's potential reactivity, particularly in nucleophilic addition reactions. Additionally, the presence of fluorine can enhance the compound's stability and alter its electronic properties, making it of interest in various fields, including pharmaceuticals and materials science. Overall, this compound's unique structure and substituents suggest potential applications in synthetic chemistry and drug development.

Formula: C₁₅H₁₂F₂O

InChI: InChI=1/C15H12F2O/c16-13-8-12(9-14(17)10-13)15(18)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2

InChI key: InChIKey=GDFFCLLFQPSHMU-UHFFFAOYSA-N

SMILES: C(CCC1=CC=CC=C1)(=O)C2=CC(F)=CC(F)=C2

Synonyms:

• 1-Propanone, 1-(3,5-difluorophenyl)-3-phenyl-
• 1-(3,5-Difluorophenyl)-3-phenylpropan-1-one
• 3′,5′-Difluoro-3-phenylpropiophenone