CAS 898788-95-9

Methanone, (2-chlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2-chlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a 2-chlorophenyl group indicates that it has a chlorine substituent on the phenyl ring, which can influence its reactivity and biological activity. Additionally, the compound features a piperazine moiety, specifically a 4-methyl-1-piperazinyl group, which is known for its role in various pharmacological activities. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The compound's molecular interactions may be influenced by the electron-withdrawing nature of the chlorine atom and the basicity of the piperazine ring. Overall, the characteristics of this compound make it a subject of interest for further research in drug development and chemical synthesis.

Formula: C₁₉H₂₁ClN₂O

InChI: InChI=1S/C19H21ClN2O/c1-21-9-11-22(12-10-21)14-15-5-4-6-16(13-15)19(23)17-7-2-3-8-18(17)20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=WWYCESLMSMJWHR-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=C(Cl)C=CC=C3

Synonyms:

• 2-Chloro-3′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (2-chlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (2-Chlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

2-chloro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-95-9

Formula: C₁₉H₂₁ClN₂O

Purity: 97.0%

Molecular weight: 328.84

Ref: 10-F205027