CAS 898788-97-1

3-(3-fluorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one

Description:

3-(3-fluorophenyl)-1-(2-methylsulfanylphenyl)propan-1-one, identified by its CAS number 898788-97-1, is an organic compound characterized by its ketone functional group and the presence of both fluorine and sulfur substituents on its aromatic rings. The structure features a propanone backbone with a 3-fluorophenyl group and a 2-methylsulfanylphenyl group, which contribute to its unique chemical properties. The fluorine atom can enhance the compound's lipophilicity and influence its reactivity, while the methylthio group may affect its electronic properties and steric hindrance. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve standard organic reactions, and it may be analyzed using techniques such as NMR, mass spectrometry, and IR spectroscopy to confirm its structure and purity. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines due to potential hazards associated with its chemical nature.

Formula: C₁₆H₁₅FOS

InChI: InChI=1/C16H15FOS/c1-19-16-8-3-2-7-14(16)15(18)10-9-12-5-4-6-13(17)11-12/h2-8,11H,9-10H2,1H3

SMILES: CSc1ccccc1C(=O)CCc1cccc(c1)F

3-(3-fluorophenyl)-2′-thiomethylpropiophenone

CAS: 898788-97-1

Formula: C₁₆H₁₅FOS

Purity: 97.0%

Molecular weight: 274.35

Ref: 10-F206266