CAS 898788-98-2

Methanone, (2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a fluorine atom on the phenyl ring suggests potential applications in medicinal chemistry, as fluorinated compounds often exhibit enhanced biological activity and metabolic stability. The incorporation of a piperazine moiety indicates potential interactions with biological targets, particularly in the realm of pharmacology, where piperazine derivatives are known for their diverse therapeutic effects. This compound's molecular structure likely contributes to its lipophilicity and ability to cross biological membranes, making it a candidate for drug development. Additionally, the specific arrangement of substituents can influence its reactivity, solubility, and overall pharmacokinetic properties. As with many synthetic organic compounds, understanding its characteristics requires consideration of its synthesis, stability, and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₉H₂₁FN₂O

InChI: InChI=1S/C19H21FN2O/c1-21-9-11-22(12-10-21)14-15-5-4-6-16(13-15)19(23)17-7-2-3-8-18(17)20/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=NBMAFRULOHYQAF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=C(F)C=CC=C3

Synonyms:

• (2-Fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

2-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898788-98-2

Formula: C₁₉H₂₁FN₂O

Purity: 97.0%

Molecular weight: 312.388

Ref: 10-F205028