CAS 898789-02-1

1-Propanone, 1-(3-bromophenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(3-bromophenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898789-02-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a bromophenyl group and a fluorophenyl group, which contribute to its chemical properties and reactivity. The presence of halogen atoms, specifically bromine and fluorine, can influence the compound's polarity, solubility, and overall reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate volatility and may have specific interactions with biological systems due to its aromatic nature. Additionally, the presence of the ketone group suggests potential for nucleophilic attack, making it a candidate for further chemical transformations. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.

Formula: C₁₅H₁₂BrFO

InChI: InChI=1S/C15H12BrFO/c16-13-5-2-4-12(10-13)15(18)8-7-11-3-1-6-14(17)9-11/h1-6,9-10H,7-8H2

InChI key: InChIKey=JVYYAIMYAAVKFG-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=CC(Br)=CC=C2

Synonyms:

• 3′-Bromo-3-(3-fluorophenyl)propiophenone
• 1-Propanone, 1-(3-bromophenyl)-3-(3-fluorophenyl)-