CymitQuimica logo

CAS 898789-04-3

:

1,3-bis(o-tolyl)propan-1-one

Description:
1,3-bis(o-tolyl)propan-1-one, identified by its CAS number 898789-04-3, is an organic compound characterized by its ketone functional group and a propanone backbone. This substance features two o-tolyl (ortho-tolyl) groups attached to the first and third carbon atoms of the propanone chain, contributing to its unique structural properties. The presence of the methyl groups in the o-tolyl substituents enhances its hydrophobic characteristics and may influence its solubility in organic solvents. Typically, compounds like this exhibit moderate to high melting and boiling points due to their molecular weight and intermolecular interactions. Additionally, 1,3-bis(o-tolyl)propan-1-one may demonstrate interesting reactivity patterns, making it a potential candidate for various applications in organic synthesis, including as a building block in the development of pharmaceuticals or agrochemicals. Its specific physical and chemical properties, such as solubility, reactivity, and stability, would be influenced by the steric and electronic effects of the o-tolyl groups.
Formula:C17H18O
InChI:InChI=1/C17H18O/c1-13-7-3-5-9-15(13)11-12-17(18)16-10-6-4-8-14(16)2/h3-10H,11-12H2,1-2H3
SMILES:Cc1ccccc1CCC(=O)c1ccccc1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.