CAS 898789-07-6

1-(m-tolyl)-3-(o-tolyl)propan-1-one

Description:

1-(m-Tolyl)-3-(o-tolyl)propan-1-one, also known by its CAS number 898789-07-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a meta-tolyl group and an ortho-tolyl group. The presence of these tolyl groups contributes to its hydrophobic nature and influences its physical properties, such as melting and boiling points, which are typically higher than those of simpler ketones due to increased molecular weight and intermolecular interactions. The compound is likely to be a solid at room temperature, exhibiting a crystalline structure. Its aromatic rings can provide stability and may also affect its reactivity, making it potentially useful in various chemical syntheses or as an intermediate in organic reactions. Additionally, the compound's unique structure may impart specific optical or electronic properties, making it of interest in materials science or pharmaceuticals. However, safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₇H₁₈O

InChI: InChI=1/C17H18O/c1-13-6-5-9-16(12-13)17(18)11-10-15-8-4-3-7-14(15)2/h3-9,12H,10-11H2,1-2H3

SMILES: Cc1cccc(c1)C(=O)CCc1ccccc1C