CymitQuimica logo

CAS 898789-08-7

:

1-Propanone, 1-(3-chlorophenyl)-3-(3-fluorophenyl)-

Description:
1-Propanone, 1-(3-chlorophenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898789-08-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-chlorophenyl group and a 3-fluorophenyl group. The presence of halogen atoms (chlorine and fluorine) on the aromatic rings can significantly influence the compound's chemical reactivity, polarity, and overall stability. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. Additionally, the presence of electronegative halogens can enhance the compound's potential for interactions in biological systems, making it of interest in medicinal chemistry and material science. The compound's physical properties, such as boiling point and melting point, would be influenced by its molecular structure and the interactions between its functional groups.
Formula:C15H12ClFO
InChI:InChI=1S/C15H12ClFO/c16-13-5-2-4-12(10-13)15(18)8-7-11-3-1-6-14(17)9-11/h1-6,9-10H,7-8H2
InChI key:InChIKey=TUFZJENLLZUSBT-UHFFFAOYSA-N
SMILES:C(CCC1=CC(F)=CC=C1)(=O)C2=CC(Cl)=CC=C2
Synonyms:
  • 3′-Chloro-3-(3-fluorophenyl)propiophenone
  • 1-Propanone, 1-(3-chlorophenyl)-3-(3-fluorophenyl)-
  • 1-(3-Chlorophenyl)-3-(3-fluorophenyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.