CAS 898789-09-8

Methanone, (4-bromo-2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (4-bromo-2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacological applications, particularly in the development of psychoactive drugs. This compound may exhibit specific interactions with biological targets due to its structural features, making it of interest in medicinal chemistry. Its molecular weight, solubility, and stability can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential, especially considering the halogenated substituents, which can influence toxicity and environmental impact. Overall, this compound represents a significant area of study in the field of organic and medicinal chemistry.

Formula: C₁₉H₂₀BrFN₂O

InChI: InChI=1S/C19H20BrFN2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)17-6-5-16(20)12-18(17)21/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=IOSIHNHVHWCVIP-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(Br)C=C1)C2=CC(CN3CCN(C)CC3)=CC=C2

Synonyms:

• (4-Bromo-2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 4-Bromo-2-fluoro-3′-(4-methylpiperazinomethyl )benzophenone
• Methanone, (4-bromo-2-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

4-bromo-2-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898789-09-8

Formula: C₁₉H₂₀BrFN₂O

Purity: 97.0%

Molecular weight: 391.284

Ref: 10-F205032