CAS 898789-11-2
:1-(4-chlorophenyl)-3-(3-fluorophenyl)propan-1-one
Description:
1-(4-chlorophenyl)-3-(3-fluorophenyl)propan-1-one, also known by its CAS number 898789-11-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a para-chlorophenyl group and a meta-fluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its unique chemical properties, including potential reactivity and biological activity. The compound is likely to exhibit moderate lipophilicity due to the aromatic rings, which can influence its solubility in organic solvents and its interaction with biological systems. Additionally, the structural arrangement may impart specific steric and electronic effects, making it of interest in medicinal chemistry and material science. Its synthesis and applications may be explored in various fields, including pharmaceuticals, where such compounds can serve as intermediates or active pharmaceutical ingredients. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12ClFO
InChI:InChI=1/C15H12ClFO/c16-13-7-5-12(6-8-13)15(18)9-4-11-2-1-3-14(17)10-11/h1-3,5-8,10H,4,9H2
SMILES:c1cc(CCC(=O)c2ccc(cc2)Cl)cc(c1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.