CAS 898789-12-3

Methanone, (2-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound also features a piperazine moiety, which is known for its role in pharmacology, often enhancing the compound's interaction with biological targets. This substance is likely to exhibit properties such as moderate solubility in organic solvents and potential activity as a pharmaceutical agent, given its structural components. The molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic systems. As with many compounds containing halogens and nitrogen heterocycles, it may also exhibit interesting electronic properties, making it a candidate for further study in medicinal chemistry and drug development. Safety and handling precautions should be observed due to the presence of halogenated groups.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1S/C19H20ClFN2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)17-6-5-16(21)12-18(17)20/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=DKVABXFLELPTGG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(F)C=C1)C2=CC(CN3CCN(C)CC3)=CC=C2

Synonyms:

• Methanone, (2-chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• 2-Chloro-4-fluoro-3′-(4-methylpiperazinomethyl) benzophenone
• (2-Chloro-4-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

2-chloro-4-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898789-12-3

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205033