CAS 898789-15-6

Methanone, (3-chloro-5-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its unique reactivity and potential biological activity. The compound features a piperazine moiety, which is known for its role in pharmacological applications, particularly in the development of psychoactive drugs. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the aromatic rings and the piperazine group. Additionally, the presence of halogens like chlorine and fluorine often enhances lipophilicity, which can affect the compound's bioavailability and pharmacokinetics. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both research and application.

Formula: C₁₉H₂₀ClFN₂O

InChI: InChI=1/C19H20ClFN2O/c1-22-5-7-23(8-6-22)13-14-3-2-4-15(9-14)19(24)16-10-17(20)12-18(21)11-16/h2-4,9-12H,5-8,13H2,1H3

InChI key: InChIKey=JQVRQDVMQRTSBU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=CC(Cl)=CC(F)=C3

Synonyms:

• 3-Chloro-5-fluoro-3′-(4-methylpiperazinomethyl) benzophenone
• Methanone, (3-chloro-5-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (3-Chloro-5-fluorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone

3-chloro-5-fluoro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898789-15-6

Formula: C₁₉H₂₀ClFN₂O

Purity: 97.0%

Molecular weight: 346.83

Ref: 10-F205034