CAS 898789-16-7

1-Propanone, 1-(3-methoxyphenyl)-3-(2-methylphenyl)-

Description:

1-Propanone, 1-(3-methoxyphenyl)-3-(2-methylphenyl)-, also known by its CAS number 898789-16-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-methoxyphenyl group and a 2-methylphenyl group. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The compound is likely to exhibit typical ketone properties, such as being a polar solvent and participating in nucleophilic addition reactions. Its aromatic substituents can contribute to stability and influence its electronic properties, potentially affecting its behavior in chemical reactions. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₁₇H₁₈O₂

InChI: InChI=1S/C17H18O2/c1-13-6-3-4-7-14(13)10-11-17(18)15-8-5-9-16(12-15)19-2/h3-9,12H,10-11H2,1-2H3

InChI key: InChIKey=XSOUEMLAOJPLBX-UHFFFAOYSA-N

SMILES: C(CCC1=C(C)C=CC=C1)(=O)C2=CC(OC)=CC=C2

Synonyms:

• 3′-Methoxy-3-(2-methylphenyl)propiophenone
• 1-(3-Methoxyphenyl)-3-(2-methylphenyl)-1-propanone
• 1-Propanone, 1-(3-methoxyphenyl)-3-(2-methylphenyl)-