CAS 898789-20-3

1-Propanone, 1-(2,3-dimethylphenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(2,3-dimethylphenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898789-20-3, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 2,3-dimethylphenyl group and a 3-fluorophenyl group. The presence of these substituents contributes to its unique chemical properties, including potential variations in polarity and reactivity. The fluorine atom in the 3-fluorophenyl group can enhance the compound's electrophilic character, making it potentially useful in various chemical reactions. Additionally, the methyl groups on the 2,3-dimethylphenyl ring can influence steric hindrance and electronic effects, affecting the compound's overall stability and reactivity. This compound may be of interest in fields such as medicinal chemistry and materials science, where the manipulation of aromatic systems is crucial for developing new drugs or materials. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-5-3-8-16(13(12)2)17(19)10-9-14-6-4-7-15(18)11-14/h3-8,11H,9-10H2,1-2H3

InChI key: InChIKey=CXHVLQXBFJPXKJ-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=C(C)C(C)=CC=C2

Synonyms:

• 1-Propanone, 1-(2,3-dimethylphenyl)-3-(3-fluorophenyl)-
• 1-(2,3-Dimethylphenyl)-3-(3-fluorophenyl)-1-propanone