CymitQuimica logo

CAS 898789-21-4

:

(2,3-dichlorophenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone

Description:
The chemical substance known as (2,3-dichlorophenyl)-[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone, with the CAS number 898789-21-4, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a piperazine moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic rings, which can influence its solubility in organic solvents. It may also demonstrate biological activity, potentially acting as a pharmacological agent, given the presence of the piperazine group, which is often associated with various therapeutic effects. The compound's molecular structure suggests it may engage in hydrogen bonding and π-π interactions, contributing to its reactivity and interactions with biological targets. Additionally, its synthesis involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and drug development.
Formula:C19H20Cl2N2O
InChI:InChI=1/C19H20Cl2N2O/c1-22-8-10-23(11-9-22)13-14-4-2-5-15(12-14)19(24)16-6-3-7-17(20)18(16)21/h2-7,12H,8-11,13H2,1H3
SMILES:CN1CCN(CC1)Cc1cccc(c1)C(=O)c1cccc(c1Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.