CAS 898789-22-5

2-[3-(o-tolyl)propanoyl]benzonitrile

Description:

2-[3-(o-Tolyl)propanoyl]benzonitrile, with the CAS number 898789-22-5, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a propanoyl group substituted with an o-tolyl group. This compound typically exhibits properties common to aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The o-tolyl group contributes to its hydrophobic characteristics, while the nitrile group may impart polar properties, influencing its solubility in different solvents. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis likely involves acylation reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, 2-[3-(o-tolyl)propanoyl]benzonitrile represents a unique chemical entity with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₇H₁₅NO

InChI: InChI=1/C17H15NO/c1-13-6-2-3-7-14(13)10-11-17(19)16-9-5-4-8-15(16)12-18/h2-9H,10-11H2,1H3

SMILES: Cc1ccccc1CCC(=O)c1ccccc1C#N

2′-cyano-3-(2-methylphenyl)propiophenone

CAS: 898789-22-5

Formula: C₁₇H₁₅NO

Purity: 97.0%

Molecular weight: 249.313

Ref: 10-F205624