CAS 898789-23-6

Methanone, (2,4-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,4-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a chemical compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a dichlorophenyl group indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The compound also features a piperazine moiety, a six-membered ring containing two nitrogen atoms, which is often associated with pharmacological properties. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular interactions may be affected by the electron-withdrawing nature of the chlorine atoms and the basicity of the piperazine, which can impact its solubility and binding affinity to biological targets. Overall, this compound exemplifies the intricate relationship between molecular structure and function in organic chemistry.

Formula: C₁₉H₂₀Cl₂N₂O

InChI: InChI=1S/C19H20Cl2N2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)17-6-5-16(20)12-18(17)21/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=YJICFXIPBQLDLS-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=C(Cl)C=C1)C2=CC(CN3CCN(C)CC3)=CC=C2

Synonyms:

• Methanone, (2,4-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-
• (2,4-Dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• 2,4-Dichloro-3′-(4-methylpiperazinomethyl )benzophenone

2,4-dichloro-3′-(4-methylpiperazinomethyl) benzophenone

CAS: 898789-23-6

Formula: C₁₉H₂₀Cl₂N₂O

Purity: 97.0%

Molecular weight: 363.28

Ref: 10-F205037