CAS 898789-25-8

Methanone, (2,5-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,5-dichlorophenyl group indicates that chlorine atoms are substituted on the phenyl ring, which can influence the compound's reactivity and biological activity. The incorporation of a piperazine moiety suggests potential pharmacological properties, as piperazine derivatives are often found in various therapeutic agents. This compound may exhibit properties such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the presence of multiple functional groups may contribute to its interactions with biological targets, making it of interest in medicinal chemistry. Overall, the unique combination of structural features in this compound may lead to diverse applications, particularly in drug development and research.

Formula: C₁₉H₂₀Cl₂N₂O

InChI: InChI=1S/C19H20Cl2N2O/c1-22-7-9-23(10-8-22)13-14-3-2-4-15(11-14)19(24)17-12-16(20)5-6-18(17)21/h2-6,11-12H,7-10,13H2,1H3

InChI key: InChIKey=XCABMQVTJSYECL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCN(C)CC2)=CC=C1)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• (2,5-Dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]methanone
• Methanone, (2,5-dichlorophenyl)[3-[(4-methyl-1-piperazinyl)methyl]phenyl]-